최소 단어 이상 선택하여야 합니다.
최대 10 단어까지만 선택 가능합니다.
다음과 같은 기능을 한번의 로그인으로 사용 할 수 있습니다.
NTIS 바로가기국가/구분 | United States(US) Patent 등록 |
---|---|
국제특허분류(IPC7판) |
|
출원번호 | US-0741090 (1976-11-11) |
발명자 / 주소 |
|
출원인 / 주소 |
|
인용정보 | 피인용 횟수 : 7 인용 특허 : 0 |
Compounds of the formula [Figure] where X represents O or S and R1 and R2 each represents lower alkyl, phenyl or (lower alkyl)phenyl. The compounds are prepared by reacting the ring-opened intermediate (obtained by reacting cis-1-(3-chloro-2-propenyl)-3,5,7-triaza-1-azoniatricyclo(3.3.1.13,7)decane
A compound corresponding to the formula [Figure] wheren X represents O or S and R1 and R2 each represents lower alkyl, phenyl or (lower alkyl)phenyl.
※ AI-Helper는 부적절한 답변을 할 수 있습니다.